ChemNet > CAS > 423768-58-5 1-cyclopropyl-2,5-dimethyl-1H-pyrrole-3-carboxylic acid
423768-58-5 1-cyclopropyl-2,5-dimethyl-1H-pyrrole-3-carboxylic acid
| Nome del prodotto |
1-cyclopropyl-2,5-dimethyl-1H-pyrrole-3-carboxylic acid |
| Formula molecolare |
C10H13NO2 |
| Peso Molecolare |
179.2157 |
| InChI |
InChI=1/C10H13NO2/c1-6-5-9(10(12)13)7(2)11(6)8-3-4-8/h5,8H,3-4H2,1-2H3,(H,12,13) |
| Numero CAS |
423768-58-5 |
| Struttura molecolare |
|
| Densità |
1.27g/cm3 |
| Punto di fusione |
177℃ |
| Punto di ebollizione |
353.1°C at 760 mmHg |
| Indice di rifrazione |
1.613 |
| Punto d'infiammabilità |
167.4°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
